C37H54O5 — CID 172632547
[(5R)-1-(2-methoxyphenyl)-5-[(1S,2R,5S,9R,13S,14S,17R,18R)-2,7,7,18-tetramethyl-6,8-dioxapentacyclo[11.7.0.02,10.05,9.014,18]icos-10-en-17-yl]hexyl] acetate (PubChem CID 172632547) has the molecular formula C37H54O5 and a molecular weight of 578.83 g/mol. Its IUPAC name is [(5R)-1-(2-methoxyphenyl)-5-[(1S,2R,5S,9R,13S,14S,17R,18R)-2,7,7,18-tetramethyl-6,8-dioxapentacyclo[11.7.0.02,10.05,9.014,18]icos-10-en-17-yl]hexyl] acetate.
| Compound Name | [(5R)-1-(2-methoxyphenyl)-5-[(1S,2R,5S,9R,13S,14S,17R,18R)-2,7,7,18-tetramethyl-6,8-dioxapentacyclo[11.7.0.02,10.05,9.014,18]icos-10-en-17-yl]hexyl] acetate |
|---|---|
| PubChem CID | 172632547 |
| Molecular Formula | C37H54O5 |
| Molecular Weight | 578.83 g/mol |
| Exact Mass | 578.40 |
| IUPAC Name | [(5R)-1-(2-methoxyphenyl)-5-[(1S,2R,5S,9R,13S,14S,17R,18R)-2,7,7,18-tetramethyl-6,8-dioxapentacyclo[11.7.0.02,10.05,9.014,18]icos-10-en-17-yl]hexyl] acetate |
| SMILES | COc1ccccc1C(CCC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CC=C4[C@H]5OC(C)(C)O[C@H]5CC[C@]4(C)[C@H]3CC[C@]12C)OC(C)=O |
| InChI | InChI=1S/C37H54O5/c1-23(11-10-14-32(40-24(2)38)26-12-8-9-13-31(26)39-7)27-17-18-28-25-15-16-30-34-33(41-35(3,4)42-34)20-22-37(30,6)29(25)19-21-36(27,28)5/h8-9,12-13,16,23,25,27-29,32-34H,10-11,14-15,17-22H2,1-7H3/t23-,25+,27-,28+,29+,32?,33+,34-,36-,37-/m1/s1 |
| InChIKey | BSYXWGCCKGOBDK-MMJLXMBRSA-N |
| XLogP | 8.81 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.83 |
| LogP ≤ 5 | 8.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|