C17H11ClFNO — CID 172635563
6-chloro-5'-fluoro-2'-methylspiro[3H-indene-2,3'-indole]-1-one (PubChem CID 172635563) has the molecular formula C17H11ClFNO and a molecular weight of 299.73 g/mol. Its IUPAC name is 6-chloro-5'-fluoro-2'-methylspiro[3H-indene-2,3'-indole]-1-one.
| Compound Name | 6-chloro-5'-fluoro-2'-methylspiro[3H-indene-2,3'-indole]-1-one |
|---|---|
| PubChem CID | 172635563 |
| Molecular Formula | C17H11ClFNO |
| Molecular Weight | 299.73 g/mol |
| Exact Mass | 299.05 |
| IUPAC Name | 6-chloro-5'-fluoro-2'-methylspiro[3H-indene-2,3'-indole]-1-one |
| SMILES | CC1=Nc2ccc(F)cc2C12Cc1ccc(Cl)cc1C2=O |
| InChI | InChI=1S/C17H11ClFNO/c1-9-17(14-7-12(19)4-5-15(14)20-9)8-10-2-3-11(18)6-13(10)16(17)21/h2-7H,8H2,1H3 |
| InChIKey | OMGQHESIZUDWRQ-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.73 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |