C18H14FNO — CID 172635561
6-fluoro-2',5'-dimethylspiro[3H-indene-2,3'-indole]-1-one (PubChem CID 172635561) has the molecular formula C18H14FNO and a molecular weight of 279.31 g/mol. Its IUPAC name is 6-fluoro-2',5'-dimethylspiro[3H-indene-2,3'-indole]-1-one.
| Compound Name | 6-fluoro-2',5'-dimethylspiro[3H-indene-2,3'-indole]-1-one |
|---|---|
| PubChem CID | 172635561 |
| Molecular Formula | C18H14FNO |
| Molecular Weight | 279.31 g/mol |
| Exact Mass | 279.11 |
| IUPAC Name | 6-fluoro-2',5'-dimethylspiro[3H-indene-2,3'-indole]-1-one |
| SMILES | CC1=Nc2ccc(C)cc2C12Cc1ccc(F)cc1C2=O |
| InChI | InChI=1S/C18H14FNO/c1-10-3-6-16-15(7-10)18(11(2)20-16)9-12-4-5-13(19)8-14(12)17(18)21/h3-8H,9H2,1-2H3 |
| InChIKey | MZDIWXMQFQCVDX-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.31 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |