C21H15F2N5O3S — CID 172636377
3,5-difluoro-N-[3-[1-(4-sulfamoylphenyl)triazol-4-yl]phenyl]benzamide (PubChem CID 172636377) has the molecular formula C21H15F2N5O3S and a molecular weight of 455.45 g/mol. Its IUPAC name is 3,5-difluoro-N-[3-[1-(4-sulfamoylphenyl)triazol-4-yl]phenyl]benzamide.
| Compound Name | 3,5-difluoro-N-[3-[1-(4-sulfamoylphenyl)triazol-4-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 172636377 |
| Molecular Formula | C21H15F2N5O3S |
| Molecular Weight | 455.45 g/mol |
| Exact Mass | 455.09 |
| IUPAC Name | 3,5-difluoro-N-[3-[1-(4-sulfamoylphenyl)triazol-4-yl]phenyl]benzamide |
| SMILES | NS(=O)(=O)c1ccc(-n2cc(-c3cccc(NC(=O)c4cc(F)cc(F)c4)c3)nn2)cc1 |
| InChI | InChI=1S/C21H15F2N5O3S/c22-15-8-14(9-16(23)11-15)21(29)25-17-3-1-2-13(10-17)20-12-28(27-26-20)18-4-6-19(7-5-18)32(24,30)31/h1-12H,(H,25,29)(H2,24,30,31) |
| InChIKey | FDAOOZVLYIQLRZ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 119.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.45 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |