C20H17FN2O4S — CID 169419474
3-fluoro-5-(4-hydroxy-2-methylphenyl)-N-(3-sulfamoylphenyl)benzamide (PubChem CID 169419474) has the molecular formula C20H17FN2O4S and a molecular weight of 400.43 g/mol. Its IUPAC name is 3-fluoro-5-(4-hydroxy-2-methylphenyl)-N-(3-sulfamoylphenyl)benzamide.
| Compound Name | 3-fluoro-5-(4-hydroxy-2-methylphenyl)-N-(3-sulfamoylphenyl)benzamide |
|---|---|
| PubChem CID | 169419474 |
| Molecular Formula | C20H17FN2O4S |
| Molecular Weight | 400.43 g/mol |
| Exact Mass | 400.09 |
| IUPAC Name | 3-fluoro-5-(4-hydroxy-2-methylphenyl)-N-(3-sulfamoylphenyl)benzamide |
| SMILES | Cc1cc(O)ccc1-c1cc(F)cc(C(=O)Nc2cccc(S(N)(=O)=O)c2)c1 |
| InChI | InChI=1S/C20H17FN2O4S/c1-12-7-17(24)5-6-19(12)13-8-14(10-15(21)9-13)20(25)23-16-3-2-4-18(11-16)28(22,26)27/h2-11,24H,1H3,(H,23,25)(H2,22,26,27) |
| InChIKey | HTTYNIXMUQMSLW-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.43 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |