C28H33N3O5 — CID 172651926
N-[4-(4-cyclohexylpiperazin-1-yl)phenyl]-5,7-dimethoxy-4-oxochromene-2-carboxamide (PubChem CID 172651926) has the molecular formula C28H33N3O5 and a molecular weight of 491.59 g/mol. Its IUPAC name is N-[4-(4-cyclohexylpiperazin-1-yl)phenyl]-5,7-dimethoxy-4-oxochromene-2-carboxamide.
| Compound Name | N-[4-(4-cyclohexylpiperazin-1-yl)phenyl]-5,7-dimethoxy-4-oxochromene-2-carboxamide |
|---|---|
| PubChem CID | 172651926 |
| Molecular Formula | C28H33N3O5 |
| Molecular Weight | 491.59 g/mol |
| Exact Mass | 491.24 |
| IUPAC Name | N-[4-(4-cyclohexylpiperazin-1-yl)phenyl]-5,7-dimethoxy-4-oxochromene-2-carboxamide |
| SMILES | COc1cc(OC)c2c(=O)cc(C(=O)Nc3ccc(N4CCN(C5CCCCC5)CC4)cc3)oc2c1 |
| InChI | InChI=1S/C28H33N3O5/c1-34-22-16-24(35-2)27-23(32)18-26(36-25(27)17-22)28(33)29-19-8-10-21(11-9-19)31-14-12-30(13-15-31)20-6-4-3-5-7-20/h8-11,16-18,20H,3-7,12-15H2,1-2H3,(H,29,33) |
| InChIKey | YQPWWBVQMIIUFB-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 84.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.59 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|