C26H29N3O6 — CID 172651916
5,7-dimethoxy-4-oxo-N-[4-[4-(propanoylamino)piperidin-1-yl]phenyl]chromene-2-carboxamide (PubChem CID 172651916) has the molecular formula C26H29N3O6 and a molecular weight of 479.53 g/mol. Its IUPAC name is 5,7-dimethoxy-4-oxo-N-[4-[4-(propanoylamino)piperidin-1-yl]phenyl]chromene-2-carboxamide.
| Compound Name | 5,7-dimethoxy-4-oxo-N-[4-[4-(propanoylamino)piperidin-1-yl]phenyl]chromene-2-carboxamide |
|---|---|
| PubChem CID | 172651916 |
| Molecular Formula | C26H29N3O6 |
| Molecular Weight | 479.53 g/mol |
| Exact Mass | 479.21 |
| IUPAC Name | 5,7-dimethoxy-4-oxo-N-[4-[4-(propanoylamino)piperidin-1-yl]phenyl]chromene-2-carboxamide |
| SMILES | CCC(=O)NC1CCN(c2ccc(NC(=O)c3cc(=O)c4c(OC)cc(OC)cc4o3)cc2)CC1 |
| InChI | InChI=1S/C26H29N3O6/c1-4-24(31)27-17-9-11-29(12-10-17)18-7-5-16(6-8-18)28-26(32)23-15-20(30)25-21(34-3)13-19(33-2)14-22(25)35-23/h5-8,13-15,17H,4,9-12H2,1-3H3,(H,27,31)(H,28,32) |
| InChIKey | CFZQPMKXEFKCHS-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 110.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.53 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|