C28H31N3O6 — CID 172651943
N-[4-[4-(cyclopentanecarbonyl)piperazin-1-yl]phenyl]-5,7-dimethoxy-4-oxochromene-2-carboxamide (PubChem CID 172651943) has the molecular formula C28H31N3O6 and a molecular weight of 505.57 g/mol. Its IUPAC name is N-[4-[4-(cyclopentanecarbonyl)piperazin-1-yl]phenyl]-5,7-dimethoxy-4-oxochromene-2-carboxamide.
| Compound Name | N-[4-[4-(cyclopentanecarbonyl)piperazin-1-yl]phenyl]-5,7-dimethoxy-4-oxochromene-2-carboxamide |
|---|---|
| PubChem CID | 172651943 |
| Molecular Formula | C28H31N3O6 |
| Molecular Weight | 505.57 g/mol |
| Exact Mass | 505.22 |
| IUPAC Name | N-[4-[4-(cyclopentanecarbonyl)piperazin-1-yl]phenyl]-5,7-dimethoxy-4-oxochromene-2-carboxamide |
| SMILES | COc1cc(OC)c2c(=O)cc(C(=O)Nc3ccc(N4CCN(C(=O)C5CCCC5)CC4)cc3)oc2c1 |
| InChI | InChI=1S/C28H31N3O6/c1-35-21-15-23(36-2)26-22(32)17-25(37-24(26)16-21)27(33)29-19-7-9-20(10-8-19)30-11-13-31(14-12-30)28(34)18-5-3-4-6-18/h7-10,15-18H,3-6,11-14H2,1-2H3,(H,29,33) |
| InChIKey | JTUPNJSAXJAKRE-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 101.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.57 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|