C24H28ClNO — CID 172652324
[4-[4-(2-methylpropyl)phenyl]-2-phenylmethoxyphenyl]methanamine;hydrochloride (PubChem CID 172652324) has the molecular formula C24H28ClNO and a molecular weight of 381.95 g/mol. Its IUPAC name is [4-[4-(2-methylpropyl)phenyl]-2-phenylmethoxyphenyl]methanamine;hydrochloride.
| Compound Name | [4-[4-(2-methylpropyl)phenyl]-2-phenylmethoxyphenyl]methanamine;hydrochloride |
|---|---|
| PubChem CID | 172652324 |
| Molecular Formula | C24H28ClNO |
| Molecular Weight | 381.95 g/mol |
| Exact Mass | 381.19 |
| IUPAC Name | [4-[4-(2-methylpropyl)phenyl]-2-phenylmethoxyphenyl]methanamine;hydrochloride |
| SMILES | CC(C)Cc1ccc(-c2ccc(CN)c(OCc3ccccc3)c2)cc1.Cl |
| InChI | InChI=1S/C24H27NO.ClH/c1-18(2)14-19-8-10-21(11-9-19)22-12-13-23(16-25)24(15-22)26-17-20-6-4-3-5-7-20;/h3-13,15,18H,14,16-17,25H2,1-2H3;1H |
| InChIKey | CQLSUUAQNHCBMO-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.95 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |