C17H21Cl2N — CID 172652284
[2-chloro-5-[4-(2-methylpropyl)phenyl]phenyl]methanamine;hydrochloride (PubChem CID 172652284) has the molecular formula C17H21Cl2N and a molecular weight of 310.27 g/mol. Its IUPAC name is [2-chloro-5-[4-(2-methylpropyl)phenyl]phenyl]methanamine;hydrochloride.
| Compound Name | [2-chloro-5-[4-(2-methylpropyl)phenyl]phenyl]methanamine;hydrochloride |
|---|---|
| PubChem CID | 172652284 |
| Molecular Formula | C17H21Cl2N |
| Molecular Weight | 310.27 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | [2-chloro-5-[4-(2-methylpropyl)phenyl]phenyl]methanamine;hydrochloride |
| SMILES | CC(C)Cc1ccc(-c2ccc(Cl)c(CN)c2)cc1.Cl |
| InChI | InChI=1S/C17H20ClN.ClH/c1-12(2)9-13-3-5-14(6-4-13)15-7-8-17(18)16(10-15)11-19;/h3-8,10,12H,9,11,19H2,1-2H3;1H |
| InChIKey | CDEJCNANDDPWFK-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.27 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |