C18H24ClN — CID 172652279
[2-methyl-5-[4-(2-methylpropyl)phenyl]phenyl]methanamine;hydrochloride (PubChem CID 172652279) has the molecular formula C18H24ClN and a molecular weight of 289.85 g/mol. Its IUPAC name is [2-methyl-5-[4-(2-methylpropyl)phenyl]phenyl]methanamine;hydrochloride.
| Compound Name | [2-methyl-5-[4-(2-methylpropyl)phenyl]phenyl]methanamine;hydrochloride |
|---|---|
| PubChem CID | 172652279 |
| Molecular Formula | C18H24ClN |
| Molecular Weight | 289.85 g/mol |
| Exact Mass | 289.16 |
| IUPAC Name | [2-methyl-5-[4-(2-methylpropyl)phenyl]phenyl]methanamine;hydrochloride |
| SMILES | Cc1ccc(-c2ccc(CC(C)C)cc2)cc1CN.Cl |
| InChI | InChI=1S/C18H23N.ClH/c1-13(2)10-15-5-8-16(9-6-15)17-7-4-14(3)18(11-17)12-19;/h4-9,11,13H,10,12,19H2,1-3H3;1H |
| InChIKey | JBURZSRXDATNRN-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.85 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |