C24H28N4O2 — CID 172657361
N-[(3aR,5S,6S,7aS)-6-hydroxy-2-(2-phenylethyl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-yl]-3H-benzimidazole-5-carboxamide (PubChem CID 172657361) has the molecular formula C24H28N4O2 and a molecular weight of 404.51 g/mol. Its IUPAC name is N-[(3aR,5S,6S,7aS)-6-hydroxy-2-(2-phenylethyl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-yl]-3H-benzimidazole-5-carboxamide.
| Compound Name | N-[(3aR,5S,6S,7aS)-6-hydroxy-2-(2-phenylethyl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-yl]-3H-benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 172657361 |
| Molecular Formula | C24H28N4O2 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.22 |
| IUPAC Name | N-[(3aR,5S,6S,7aS)-6-hydroxy-2-(2-phenylethyl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-yl]-3H-benzimidazole-5-carboxamide |
| SMILES | O=C(N[C@H]1C[C@H]2CN(CCc3ccccc3)C[C@H]2C[C@@H]1O)c1ccc2nc[nH]c2c1 |
| InChI | InChI=1S/C24H28N4O2/c29-23-12-19-14-28(9-8-16-4-2-1-3-5-16)13-18(19)11-22(23)27-24(30)17-6-7-20-21(10-17)26-15-25-20/h1-7,10,15,18-19,22-23,29H,8-9,11-14H2,(H,25,26)(H,27,30)/t18-,19+,22-,23-/m0/s1 |
| InChIKey | CIPJIUGGQPZDPZ-YDLSIGKMSA-N |
| XLogP | 2.61 |
| TPSA | 81.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |