C20H22N4O3S — CID 110347120
3H-benzimidazol-5-yl-[4-(2-phenylethylsulfonyl)piperazin-1-yl]methanone (PubChem CID 110347120) has the molecular formula C20H22N4O3S and a molecular weight of 398.49 g/mol. Its IUPAC name is 3H-benzimidazol-5-yl-[4-(2-phenylethylsulfonyl)piperazin-1-yl]methanone.
| Compound Name | 3H-benzimidazol-5-yl-[4-(2-phenylethylsulfonyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 110347120 |
| Molecular Formula | C20H22N4O3S |
| Molecular Weight | 398.49 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | 3H-benzimidazol-5-yl-[4-(2-phenylethylsulfonyl)piperazin-1-yl]methanone |
| SMILES | O=C(c1ccc2nc[nH]c2c1)N1CCN(S(=O)(=O)CCc2ccccc2)CC1 |
| InChI | InChI=1S/C20H22N4O3S/c25-20(17-6-7-18-19(14-17)22-15-21-18)23-9-11-24(12-10-23)28(26,27)13-8-16-4-2-1-3-5-16/h1-7,14-15H,8-13H2,(H,21,22) |
| InChIKey | DEVYSELRHMPCMN-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 86.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.49 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |