C20H28N2O3S2 — CID 172658491
N-[(3aR,5S,6S,7aS)-6-(cyclopropylmethoxy)-2-(2-methylsulfanylacetyl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-yl]thiophene-3-carboxamide (PubChem CID 172658491) has the molecular formula C20H28N2O3S2 and a molecular weight of 408.59 g/mol. Its IUPAC name is N-[(3aR,5S,6S,7aS)-6-(cyclopropylmethoxy)-2-(2-methylsulfanylacetyl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-yl]thiophene-3-carboxamide.
| Compound Name | N-[(3aR,5S,6S,7aS)-6-(cyclopropylmethoxy)-2-(2-methylsulfanylacetyl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-yl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 172658491 |
| Molecular Formula | C20H28N2O3S2 |
| Molecular Weight | 408.59 g/mol |
| Exact Mass | 408.15 |
| IUPAC Name | N-[(3aR,5S,6S,7aS)-6-(cyclopropylmethoxy)-2-(2-methylsulfanylacetyl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-yl]thiophene-3-carboxamide |
| SMILES | CSCC(=O)N1C[C@H]2C[C@H](OCC3CC3)[C@@H](NC(=O)c3ccsc3)C[C@H]2C1 |
| InChI | InChI=1S/C20H28N2O3S2/c1-26-12-19(23)22-8-15-6-17(21-20(24)14-4-5-27-11-14)18(7-16(15)9-22)25-10-13-2-3-13/h4-5,11,13,15-18H,2-3,6-10,12H2,1H3,(H,21,24)/t15-,16+,17-,18-/m0/s1 |
| InChIKey | SBHJPVYFROOTKQ-MHORFTMASA-N |
| XLogP | 2.87 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.59 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |