C21H31N3O3 — CID 172662130
[(3aS,5R,6R,7aR)-5-[(2,6-dimethyl-3-pyridinyl)oxy]-6-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(1-aminocyclopentyl)methanone (PubChem CID 172662130) has the molecular formula C21H31N3O3 and a molecular weight of 373.50 g/mol. Its IUPAC name is [(3aS,5R,6R,7aR)-5-[(2,6-dimethyl-3-pyridinyl)oxy]-6-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(1-aminocyclopentyl)methanone.
| Compound Name | [(3aS,5R,6R,7aR)-5-[(2,6-dimethyl-3-pyridinyl)oxy]-6-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(1-aminocyclopentyl)methanone |
|---|---|
| PubChem CID | 172662130 |
| Molecular Formula | C21H31N3O3 |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.24 |
| IUPAC Name | [(3aS,5R,6R,7aR)-5-[(2,6-dimethyl-3-pyridinyl)oxy]-6-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(1-aminocyclopentyl)methanone |
| SMILES | Cc1ccc(O[C@@H]2C[C@@H]3CN(C(=O)C4(N)CCCC4)C[C@@H]3C[C@H]2O)c(C)n1 |
| InChI | InChI=1S/C21H31N3O3/c1-13-5-6-18(14(2)23-13)27-19-10-16-12-24(11-15(16)9-17(19)25)20(26)21(22)7-3-4-8-21/h5-6,15-17,19,25H,3-4,7-12,22H2,1-2H3/t15-,16+,17+,19+/m0/s1 |
| InChIKey | CMILXJDIDVUGTC-DODZYUBVSA-N |
| XLogP | 1.95 |
| TPSA | 88.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |