C21H30N4O4 — CID 172668673
1-[2-[(3aS,5R,6R,7aR)-5-[(2,6-dimethyl-3-pyridinyl)oxy]-6-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-2-oxoethyl]-3-methylimidazolidin-2-one (PubChem CID 172668673) has the molecular formula C21H30N4O4 and a molecular weight of 402.50 g/mol. Its IUPAC name is 1-[2-[(3aS,5R,6R,7aR)-5-[(2,6-dimethyl-3-pyridinyl)oxy]-6-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-2-oxoethyl]-3-methylimidazolidin-2-one.
| Compound Name | 1-[2-[(3aS,5R,6R,7aR)-5-[(2,6-dimethyl-3-pyridinyl)oxy]-6-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-2-oxoethyl]-3-methylimidazolidin-2-one |
|---|---|
| PubChem CID | 172668673 |
| Molecular Formula | C21H30N4O4 |
| Molecular Weight | 402.50 g/mol |
| Exact Mass | 402.23 |
| IUPAC Name | 1-[2-[(3aS,5R,6R,7aR)-5-[(2,6-dimethyl-3-pyridinyl)oxy]-6-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-2-oxoethyl]-3-methylimidazolidin-2-one |
| SMILES | Cc1ccc(O[C@@H]2C[C@@H]3CN(C(=O)CN4CCN(C)C4=O)C[C@@H]3C[C@H]2O)c(C)n1 |
| InChI | InChI=1S/C21H30N4O4/c1-13-4-5-18(14(2)22-13)29-19-9-16-11-25(10-15(16)8-17(19)26)20(27)12-24-7-6-23(3)21(24)28/h4-5,15-17,19,26H,6-12H2,1-3H3/t15-,16+,17+,19+/m0/s1 |
| InChIKey | QMZNMWQLJUOTCS-DODZYUBVSA-N |
| XLogP | 1.04 |
| TPSA | 86.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.50 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |