C25H28N4O3 — CID 172656426
[(3aS,5R,6R,7aR)-5-[(2,6-dimethyl-3-pyridinyl)oxy]-6-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-[4-(1H-pyrazol-5-yl)phenyl]methanone (PubChem CID 172656426) has the molecular formula C25H28N4O3 and a molecular weight of 432.52 g/mol. Its IUPAC name is [(3aS,5R,6R,7aR)-5-[(2,6-dimethyl-3-pyridinyl)oxy]-6-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-[4-(1H-pyrazol-5-yl)phenyl]methanone.
| Compound Name | [(3aS,5R,6R,7aR)-5-[(2,6-dimethyl-3-pyridinyl)oxy]-6-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-[4-(1H-pyrazol-5-yl)phenyl]methanone |
|---|---|
| PubChem CID | 172656426 |
| Molecular Formula | C25H28N4O3 |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.22 |
| IUPAC Name | [(3aS,5R,6R,7aR)-5-[(2,6-dimethyl-3-pyridinyl)oxy]-6-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-[4-(1H-pyrazol-5-yl)phenyl]methanone |
| SMILES | Cc1ccc(O[C@@H]2C[C@@H]3CN(C(=O)c4ccc(-c5ccn[nH]5)cc4)C[C@@H]3C[C@H]2O)c(C)n1 |
| InChI | InChI=1S/C25H28N4O3/c1-15-3-8-23(16(2)27-15)32-24-12-20-14-29(13-19(20)11-22(24)30)25(31)18-6-4-17(5-7-18)21-9-10-26-28-21/h3-10,19-20,22,24,30H,11-14H2,1-2H3,(H,26,28)/t19-,20+,22+,24+/m0/s1 |
| InChIKey | PGQDPGKGJUGSRP-LNGMVNIQSA-N |
| XLogP | 3.38 |
| TPSA | 91.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |