C23H26N4O3 — CID 172660618
[(3aS,5R,6R,7aR)-5-[(2,6-dimethyl-3-pyridinyl)oxy]-6-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(1H-indazol-7-yl)methanone (PubChem CID 172660618) has the molecular formula C23H26N4O3 and a molecular weight of 406.49 g/mol. Its IUPAC name is [(3aS,5R,6R,7aR)-5-[(2,6-dimethyl-3-pyridinyl)oxy]-6-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(1H-indazol-7-yl)methanone.
| Compound Name | [(3aS,5R,6R,7aR)-5-[(2,6-dimethyl-3-pyridinyl)oxy]-6-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(1H-indazol-7-yl)methanone |
|---|---|
| PubChem CID | 172660618 |
| Molecular Formula | C23H26N4O3 |
| Molecular Weight | 406.49 g/mol |
| Exact Mass | 406.20 |
| IUPAC Name | [(3aS,5R,6R,7aR)-5-[(2,6-dimethyl-3-pyridinyl)oxy]-6-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(1H-indazol-7-yl)methanone |
| SMILES | Cc1ccc(O[C@@H]2C[C@@H]3CN(C(=O)c4cccc5cn[nH]c45)C[C@@H]3C[C@H]2O)c(C)n1 |
| InChI | InChI=1S/C23H26N4O3/c1-13-6-7-20(14(2)25-13)30-21-9-17-12-27(11-16(17)8-19(21)28)23(29)18-5-3-4-15-10-24-26-22(15)18/h3-7,10,16-17,19,21,28H,8-9,11-12H2,1-2H3,(H,24,26)/t16-,17+,19+,21+/m0/s1 |
| InChIKey | ALCXDKHHCKGSQD-GMLUQMLDSA-N |
| XLogP | 2.87 |
| TPSA | 91.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.49 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |