C48H93N3O8 — CID 172677391
2-[2-[3-[bis(2-hydroxyethyl)amino]propylcarbamoyloxy]ethyl-[2-(2-hexyldecanoyloxy)ethyl]amino]ethyl (Z)-octadec-9-enoate (PubChem CID 172677391) has the molecular formula C48H93N3O8 and a molecular weight of 840.28 g/mol. Its IUPAC name is 2-[2-[3-[bis(2-hydroxyethyl)amino]propylcarbamoyloxy]ethyl-[2-(2-hexyldecanoyloxy)ethyl]amino]ethyl (Z)-octadec-9-enoate.
| Compound Name | 2-[2-[3-[bis(2-hydroxyethyl)amino]propylcarbamoyloxy]ethyl-[2-(2-hexyldecanoyloxy)ethyl]amino]ethyl (Z)-octadec-9-enoate |
|---|---|
| PubChem CID | 172677391 |
| Molecular Formula | C48H93N3O8 |
| Molecular Weight | 840.28 g/mol |
| Exact Mass | 839.70 |
| IUPAC Name | 2-[2-[3-[bis(2-hydroxyethyl)amino]propylcarbamoyloxy]ethyl-[2-(2-hexyldecanoyloxy)ethyl]amino]ethyl (Z)-octadec-9-enoate |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)OCCN(CCOC(=O)NCCCN(CCO)CCO)CCOC(=O)C(CCCCCC)CCCCCCCC |
| InChI | InChI=1S/C48H93N3O8/c1-4-7-10-13-15-16-17-18-19-20-21-22-23-25-28-32-46(54)57-42-37-51(39-44-59-48(56)49-33-29-34-50(35-40-52)36-41-53)38-43-58-47(55)45(30-26-12-9-6-3)31-27-24-14-11-8-5-2/h18-19,45,52-53H,4-17,20-44H2,1-3H3,(H,49,56)/b19-18- |
| InChIKey | NKBLIRCFPYOMID-HNENSFHCSA-N |
| XLogP | 10.15 |
| TPSA | 137.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 45 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 840.28 |
| LogP ≤ 5 | 10.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|