C21H29F2N7O2 — CID 172681713
[1-[5-(2-amino-3H-pyrazol-1-yl)-2,3-difluoro-4-pyridinyl]piperidin-4-yl]-[4-(oxetan-3-yl)piperazin-1-yl]methanone (PubChem CID 172681713) has the molecular formula C21H29F2N7O2 and a molecular weight of 449.51 g/mol. Its IUPAC name is [1-[5-(2-amino-3H-pyrazol-1-yl)-2,3-difluoro-4-pyridinyl]piperidin-4-yl]-[4-(oxetan-3-yl)piperazin-1-yl]methanone.
| Compound Name | [1-[5-(2-amino-3H-pyrazol-1-yl)-2,3-difluoro-4-pyridinyl]piperidin-4-yl]-[4-(oxetan-3-yl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 172681713 |
| Molecular Formula | C21H29F2N7O2 |
| Molecular Weight | 449.51 g/mol |
| Exact Mass | 449.24 |
| IUPAC Name | [1-[5-(2-amino-3H-pyrazol-1-yl)-2,3-difluoro-4-pyridinyl]piperidin-4-yl]-[4-(oxetan-3-yl)piperazin-1-yl]methanone |
| SMILES | NN1CC=CN1c1cnc(F)c(F)c1N1CCC(C(=O)N2CCN(C3COC3)CC2)CC1 |
| InChI | InChI=1S/C21H29F2N7O2/c22-18-19(17(12-25-20(18)23)29-4-1-5-30(29)24)27-6-2-15(3-7-27)21(31)28-10-8-26(9-11-28)16-13-32-14-16/h1,4,12,15-16H,2-3,5-11,13-14,24H2 |
| InChIKey | AMLFIMBGPNVNCH-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 81.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.51 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|