C21H17ClN2PS+ — CID 172682585
[2-(5-chloro-1,2,4-thiadiazol-3-yl)phenyl]-methyl-diphenylphosphanium (PubChem CID 172682585) has the molecular formula C21H17ClN2PS+ and a molecular weight of 395.88 g/mol. Its IUPAC name is [2-(5-chloro-1,2,4-thiadiazol-3-yl)phenyl]-methyl-diphenylphosphanium.
| Compound Name | [2-(5-chloro-1,2,4-thiadiazol-3-yl)phenyl]-methyl-diphenylphosphanium |
|---|---|
| PubChem CID | 172682585 |
| Molecular Formula | C21H17ClN2PS+ |
| Molecular Weight | 395.88 g/mol |
| Exact Mass | 395.05 |
| IUPAC Name | [2-(5-chloro-1,2,4-thiadiazol-3-yl)phenyl]-methyl-diphenylphosphanium |
| SMILES | C[P+](c1ccccc1)(c1ccccc1)c1ccccc1-c1nsc(Cl)n1 |
| InChI | InChI=1S/C21H17ClN2PS/c1-25(16-10-4-2-5-11-16,17-12-6-3-7-13-17)19-15-9-8-14-18(19)20-23-21(22)26-24-20/h2-15H,1H3/q+1 |
| InChIKey | MSHSCBKEDZLVDI-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.88 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|