C27H25BrO2P+ — CID 175346619
[2-(4-bromo-2,6-dimethoxyphenyl)phenyl]-methyl-diphenylphosphanium (PubChem CID 175346619) has the molecular formula C27H25BrO2P+ and a molecular weight of 492.37 g/mol. Its IUPAC name is [2-(4-bromo-2,6-dimethoxyphenyl)phenyl]-methyl-diphenylphosphanium.
| Compound Name | [2-(4-bromo-2,6-dimethoxyphenyl)phenyl]-methyl-diphenylphosphanium |
|---|---|
| PubChem CID | 175346619 |
| Molecular Formula | C27H25BrO2P+ |
| Molecular Weight | 492.37 g/mol |
| Exact Mass | 491.08 |
| IUPAC Name | [2-(4-bromo-2,6-dimethoxyphenyl)phenyl]-methyl-diphenylphosphanium |
| SMILES | COc1cc(Br)cc(OC)c1-c1ccccc1[P+](C)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H25BrO2P/c1-29-24-18-20(28)19-25(30-2)27(24)23-16-10-11-17-26(23)31(3,21-12-6-4-7-13-21)22-14-8-5-9-15-22/h4-19H,1-3H3/q+1 |
| InChIKey | PBRHAMVJHBUNGS-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.37 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|