C14H18O3 — CID 172686091
(E)-3-(6-but-1-enyl-4-hydroxy-6-methylcyclohexa-2,4-dien-1-yl)prop-2-enoic acid (PubChem CID 172686091) has the molecular formula C14H18O3 and a molecular weight of 234.29 g/mol. Its IUPAC name is (E)-3-(6-but-1-enyl-4-hydroxy-6-methylcyclohexa-2,4-dien-1-yl)prop-2-enoic acid.
| Compound Name | (E)-3-(6-but-1-enyl-4-hydroxy-6-methylcyclohexa-2,4-dien-1-yl)prop-2-enoic acid |
|---|---|
| PubChem CID | 172686091 |
| Molecular Formula | C14H18O3 |
| Molecular Weight | 234.29 g/mol |
| Exact Mass | 234.13 |
| IUPAC Name | (E)-3-(6-but-1-enyl-4-hydroxy-6-methylcyclohexa-2,4-dien-1-yl)prop-2-enoic acid |
| SMILES | CCC=CC1(C)C=C(O)C=CC1/C=C/C(=O)O |
| InChI | InChI=1S/C14H18O3/c1-3-4-9-14(2)10-12(15)7-5-11(14)6-8-13(16)17/h4-11,15H,3H2,1-2H3,(H,16,17)/b8-6+,9-4? |
| InChIKey | BBCDLMSAKCLTCP-OGEONMARSA-N |
| XLogP | 3.23 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.29 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|