C30H27S3Sb — CID 172689484
tris[(4-buta-1,3-dienylphenyl)sulfanyl]stibane (PubChem CID 172689484) has the molecular formula C30H27S3Sb and a molecular weight of 605.51 g/mol. Its IUPAC name is tris[(4-buta-1,3-dienylphenyl)sulfanyl]stibane.
| Compound Name | tris[(4-buta-1,3-dienylphenyl)sulfanyl]stibane |
|---|---|
| PubChem CID | 172689484 |
| Molecular Formula | C30H27S3Sb |
| Molecular Weight | 605.51 g/mol |
| Exact Mass | 604.03 |
| IUPAC Name | tris[(4-buta-1,3-dienylphenyl)sulfanyl]stibane |
| SMILES | C=CC=Cc1ccc(S[Sb](Sc2ccc(C=CC=C)cc2)Sc2ccc(C=CC=C)cc2)cc1 |
| InChI | InChI=1S/3C10H10S.Sb/c3*1-2-3-4-9-5-7-10(11)8-6-9;/h3*2-8,11H,1H2;/q;;;+3/p-3 |
| InChIKey | BMDNCIUGJXNENN-UHFFFAOYSA-K |
| XLogP | 9.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.51 |
| LogP ≤ 5 | 9.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|