About tris[(4-buta-1,3-dienylphenyl)sulfanyl]stibane
tris[(4-buta-1,3-dienylphenyl)sulfanyl]stibane (PubChem CID 172689484) has the molecular formula C30H27S3Sb
and a molecular weight of 605.51 g/mol. Its IUPAC name is tris[(4-buta-1,3-dienylphenyl)sulfanyl]stibane.
Molecular Properties
| Compound Name | tris[(4-buta-1,3-dienylphenyl)sulfanyl]stibane |
| PubChem CID | 172689484 |
| Molecular Formula | C30H27S3Sb |
| Molecular Weight | 605.51 g/mol |
| Exact Mass | 604.03 |
| IUPAC Name | tris[(4-buta-1,3-dienylphenyl)sulfanyl]stibane |
| SMILES | C=CC=Cc1ccc(S[Sb](Sc2ccc(C=CC=C)cc2)Sc2ccc(C=CC=C)cc2)cc1 |
| InChI | InChI=1S/3C10H10S.Sb/c3*1-2-3-4-9-5-7-10(11)8-6-9;/h3*2-8,11H,1H2;/q;;;+3/p-3 |
| InChIKey | BMDNCIUGJXNENN-UHFFFAOYSA-K |
| XLogP | 9.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 605.51 |
| LogP ≤ 5 | 9.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze tris[(4-buta-1,3-dienylphenyl)sulfanyl]stibane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tris[(4-buta-1,3-dienylphenyl)sulfanyl]stibane?
The IUPAC name of tris[(4-buta-1,3-dienylphenyl)sulfanyl]stibane (CID 172689484) is tris[(4-buta-1,3-dienylphenyl)sulfanyl]stibane.
What is the SMILES notation for tris[(4-buta-1,3-dienylphenyl)sulfanyl]stibane?
The canonical SMILES for tris[(4-buta-1,3-dienylphenyl)sulfanyl]stibane is C=CC=Cc1ccc(S[Sb](Sc2ccc(C=CC=C)cc2)Sc2ccc(C=CC=C)cc2)cc1.
What is the InChIKey of tris[(4-buta-1,3-dienylphenyl)sulfanyl]stibane?
The InChIKey is BMDNCIUGJXNENN-UHFFFAOYSA-K. The full InChI is InChI=1S/3C10H10S.Sb/c3*1-2-3-4-9-5-7-10(11)8-6-9;/h3*2-8,11H,1H2;/q;;;+3/p-3.
What are the key properties of tris[(4-buta-1,3-dienylphenyl)sulfanyl]stibane?
tris[(4-buta-1,3-dienylphenyl)sulfanyl]stibane has a molecular weight of 605.51 g/mol, XLogP of 9.95, 12 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tris[(4-buta-1,3-dienylphenyl)sulfanyl]stibane is sourced from PubChem (CID 172689484), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).