C54H45S6Sb3 — CID 172769796
[3,5-bis[bis[(4-ethenylphenyl)sulfanyl]stibanyl]phenyl]-bis[(4-ethenylphenyl)sulfanyl]stibane (PubChem CID 172769796) has the molecular formula C54H45S6Sb3 and a molecular weight of 1251.64 g/mol. Its IUPAC name is [3,5-bis[bis[(4-ethenylphenyl)sulfanyl]stibanyl]phenyl]-bis[(4-ethenylphenyl)sulfanyl]stibane.
| Compound Name | [3,5-bis[bis[(4-ethenylphenyl)sulfanyl]stibanyl]phenyl]-bis[(4-ethenylphenyl)sulfanyl]stibane |
|---|---|
| PubChem CID | 172769796 |
| Molecular Formula | C54H45S6Sb3 |
| Molecular Weight | 1251.64 g/mol |
| Exact Mass | 1247.90 |
| IUPAC Name | [3,5-bis[bis[(4-ethenylphenyl)sulfanyl]stibanyl]phenyl]-bis[(4-ethenylphenyl)sulfanyl]stibane |
| SMILES | C=Cc1ccc(S[Sb](Sc2ccc(C=C)cc2)c2cc([Sb](Sc3ccc(C=C)cc3)Sc3ccc(C=C)cc3)cc([Sb](Sc3ccc(C=C)cc3)Sc3ccc(C=C)cc3)c2)cc1 |
| InChI | InChI=1S/6C8H8S.C6H3.3Sb/c6*1-2-7-3-5-8(9)6-4-7;1-2-4-6-5-3-1;;;/h6*2-6,9H,1H2;1,4-5H;;;/q;;;;;;;3*+2/p-6 |
| InChIKey | MUNBUTBPLZVIAS-UHFFFAOYSA-H |
| XLogP | 15.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1251.64 |
| LogP ≤ 5 | 15.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|