C15H25NO5 — CID 172689609
tert-butyl N-[(3S)-3-[(2R)-2-methyloxiran-2-yl]-3-[(3R)-oxolan-3-yl]propanoyl]carbamate (PubChem CID 172689609) has the molecular formula C15H25NO5 and a molecular weight of 299.37 g/mol. Its IUPAC name is tert-butyl N-[(3S)-3-[(2R)-2-methyloxiran-2-yl]-3-[(3R)-oxolan-3-yl]propanoyl]carbamate.
| Compound Name | tert-butyl N-[(3S)-3-[(2R)-2-methyloxiran-2-yl]-3-[(3R)-oxolan-3-yl]propanoyl]carbamate |
|---|---|
| PubChem CID | 172689609 |
| Molecular Formula | C15H25NO5 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.17 |
| IUPAC Name | tert-butyl N-[(3S)-3-[(2R)-2-methyloxiran-2-yl]-3-[(3R)-oxolan-3-yl]propanoyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(=O)C[C@@H]([C@H]1CCOC1)[C@]1(C)CO1 |
| InChI | InChI=1S/C15H25NO5/c1-14(2,3)21-13(18)16-12(17)7-11(15(4)9-20-15)10-5-6-19-8-10/h10-11H,5-9H2,1-4H3,(H,16,17,18)/t10-,11-,15-/m0/s1 |
| InChIKey | BMPKDTQOLVIOHJ-PGUXBMHVSA-N |
| XLogP | 1.87 |
| TPSA | 77.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|