C22H28FNO2 — CID 172690145
4-[4-[(1-tert-butylpiperidin-4-yl)methoxy]-3-fluorophenyl]phenol (PubChem CID 172690145) has the molecular formula C22H28FNO2 and a molecular weight of 357.47 g/mol. Its IUPAC name is 4-[4-[(1-tert-butylpiperidin-4-yl)methoxy]-3-fluorophenyl]phenol.
| Compound Name | 4-[4-[(1-tert-butylpiperidin-4-yl)methoxy]-3-fluorophenyl]phenol |
|---|---|
| PubChem CID | 172690145 |
| Molecular Formula | C22H28FNO2 |
| Molecular Weight | 357.47 g/mol |
| Exact Mass | 357.21 |
| IUPAC Name | 4-[4-[(1-tert-butylpiperidin-4-yl)methoxy]-3-fluorophenyl]phenol |
| SMILES | CC(C)(C)N1CCC(COc2ccc(-c3ccc(O)cc3)cc2F)CC1 |
| InChI | InChI=1S/C22H28FNO2/c1-22(2,3)24-12-10-16(11-13-24)15-26-21-9-6-18(14-20(21)23)17-4-7-19(25)8-5-17/h4-9,14,16,25H,10-13,15H2,1-3H3 |
| InChIKey | BOMOLVVMESAKPJ-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.47 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |