C16H23FN2O5 — CID 172691375
tert-butyl N-[(2S,3S)-2-amino-4-fluoro-3-phenylmethoxybutanoyl]-N-hydroxycarbamate (PubChem CID 172691375) has the molecular formula C16H23FN2O5 and a molecular weight of 342.37 g/mol. Its IUPAC name is tert-butyl N-[(2S,3S)-2-amino-4-fluoro-3-phenylmethoxybutanoyl]-N-hydroxycarbamate.
| Compound Name | tert-butyl N-[(2S,3S)-2-amino-4-fluoro-3-phenylmethoxybutanoyl]-N-hydroxycarbamate |
|---|---|
| PubChem CID | 172691375 |
| Molecular Formula | C16H23FN2O5 |
| Molecular Weight | 342.37 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | tert-butyl N-[(2S,3S)-2-amino-4-fluoro-3-phenylmethoxybutanoyl]-N-hydroxycarbamate |
| SMILES | CC(C)(C)OC(=O)N(O)C(=O)[C@@H](N)[C@@H](CF)OCc1ccccc1 |
| InChI | InChI=1S/C16H23FN2O5/c1-16(2,3)24-15(21)19(22)14(20)13(18)12(9-17)23-10-11-7-5-4-6-8-11/h4-8,12-13,22H,9-10,18H2,1-3H3/t12-,13+/m1/s1 |
| InChIKey | BSLXJXOYQWEYTG-OLZOCXBDSA-N |
| XLogP | 2.02 |
| TPSA | 102.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.37 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|