C10H11N3O — CID 172692662
N,N-dimethyl-4-(oxadiazol-4-yl)aniline (PubChem CID 172692662) has the molecular formula C10H11N3O and a molecular weight of 189.22 g/mol. Its IUPAC name is N,N-dimethyl-4-(oxadiazol-4-yl)aniline.
| Compound Name | N,N-dimethyl-4-(oxadiazol-4-yl)aniline |
|---|---|
| PubChem CID | 172692662 |
| Molecular Formula | C10H11N3O |
| Molecular Weight | 189.22 g/mol |
| Exact Mass | 189.09 |
| IUPAC Name | N,N-dimethyl-4-(oxadiazol-4-yl)aniline |
| SMILES | CN(C)c1ccc(-c2conn2)cc1 |
| InChI | InChI=1S/C10H11N3O/c1-13(2)9-5-3-8(4-6-9)10-7-14-12-11-10/h3-7H,1-2H3 |
| InChIKey | BWWLHVDUXBQEFV-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 42.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.22 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |