C12H19NO2 — CID 172700562
[4-(1,3-dimethoxypropyl)phenyl]methanamine (PubChem CID 172700562) has the molecular formula C12H19NO2 and a molecular weight of 209.29 g/mol. Its IUPAC name is [4-(1,3-dimethoxypropyl)phenyl]methanamine.
| Compound Name | [4-(1,3-dimethoxypropyl)phenyl]methanamine |
|---|---|
| PubChem CID | 172700562 |
| Molecular Formula | C12H19NO2 |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.14 |
| IUPAC Name | [4-(1,3-dimethoxypropyl)phenyl]methanamine |
| SMILES | COCCC(OC)c1ccc(CN)cc1 |
| InChI | InChI=1S/C12H19NO2/c1-14-8-7-12(15-2)11-5-3-10(9-13)4-6-11/h3-6,12H,7-9,13H2,1-2H3 |
| InChIKey | CXFBBZACWNSGOK-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |