C51H80O7 — CID 172710524
2,5-diethyl-3-(hydroxymethyl)-2,5-bis[(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoxy]hexanedioic acid (PubChem CID 172710524) has the molecular formula C51H80O7 and a molecular weight of 805.19 g/mol. Its IUPAC name is 2,5-diethyl-3-(hydroxymethyl)-2,5-bis[(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoxy]hexanedioic acid.
| Compound Name | 2,5-diethyl-3-(hydroxymethyl)-2,5-bis[(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoxy]hexanedioic acid |
|---|---|
| PubChem CID | 172710524 |
| Molecular Formula | C51H80O7 |
| Molecular Weight | 805.19 g/mol |
| Exact Mass | 804.59 |
| IUPAC Name | 2,5-diethyl-3-(hydroxymethyl)-2,5-bis[(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoxy]hexanedioic acid |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCCCOC(CC)(CC(CO)C(CC)(OCCCC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CC)C(=O)O)C(=O)O |
| InChI | InChI=1S/C51H80O7/c1-5-9-11-13-15-17-19-21-23-25-27-29-31-33-35-37-39-41-43-57-50(7-3,48(53)54)45-47(46-52)51(8-4,49(55)56)58-44-42-40-38-36-34-32-30-28-26-24-22-20-18-16-14-12-10-6-2/h9-12,15-18,21-24,27-30,33-36,47,52H,5-8,13-14,19-20,25-26,31-32,37-46H2,1-4H3,(H,53,54)(H,55,56)/b11-9-,12-10-,17-15-,18-16-,23-21-,24-22-,29-27-,30-28-,35-33-,36-34- |
| InChIKey | FELYMPWCFNGFAX-VDNBULCGSA-N |
| XLogP | 13.33 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 805.19 |
| LogP ≤ 5 | 13.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|