About isocyanic acid;pentanedioic acid
isocyanic acid;pentanedioic acid (PubChem CID 172714238) has the molecular formula C6H9NO5
and a molecular weight of 175.14 g/mol. Its IUPAC name is isocyanic acid;pentanedioic acid.
Molecular Properties
| Compound Name | isocyanic acid;pentanedioic acid |
| PubChem CID | 172714238 |
| Molecular Formula | C6H9NO5 |
| Molecular Weight | 175.14 g/mol |
| Exact Mass | 175.05 |
| IUPAC Name | isocyanic acid;pentanedioic acid |
| SMILES | N=C=O.O=C(O)CCCC(=O)O |
| InChI | InChI=1S/C5H8O4.CHNO/c6-4(7)2-1-3-5(8)9;2-1-3/h1-3H2,(H,6,7)(H,8,9);2H |
| InChIKey | FQOAJMILFRQQMM-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 115.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.14 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze isocyanic acid;pentanedioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of isocyanic acid;pentanedioic acid?
The IUPAC name of isocyanic acid;pentanedioic acid (CID 172714238) is isocyanic acid;pentanedioic acid.
What is the SMILES notation for isocyanic acid;pentanedioic acid?
The canonical SMILES for isocyanic acid;pentanedioic acid is N=C=O.O=C(O)CCCC(=O)O.
What is the InChIKey of isocyanic acid;pentanedioic acid?
The InChIKey is FQOAJMILFRQQMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8O4.CHNO/c6-4(7)2-1-3-5(8)9;2-1-3/h1-3H2,(H,6,7)(H,8,9);2H.
What are the key properties of isocyanic acid;pentanedioic acid?
isocyanic acid;pentanedioic acid has a molecular weight of 175.14 g/mol, XLogP of 0.23, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for isocyanic acid;pentanedioic acid is sourced from PubChem (CID 172714238), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).