C16H23ClN4O5 — CID 172722165
[(5R)-5-[3-chloro-2-(dimethylcarbamoyl)-6-nitroanilino]hexyl]carbamic acid (PubChem CID 172722165) has the molecular formula C16H23ClN4O5 and a molecular weight of 386.84 g/mol. Its IUPAC name is [(5R)-5-[3-chloro-2-(dimethylcarbamoyl)-6-nitroanilino]hexyl]carbamic acid.
| Compound Name | [(5R)-5-[3-chloro-2-(dimethylcarbamoyl)-6-nitroanilino]hexyl]carbamic acid |
|---|---|
| PubChem CID | 172722165 |
| Molecular Formula | C16H23ClN4O5 |
| Molecular Weight | 386.84 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | [(5R)-5-[3-chloro-2-(dimethylcarbamoyl)-6-nitroanilino]hexyl]carbamic acid |
| SMILES | C[C@H](CCCCNC(=O)O)Nc1c([N+](=O)[O-])ccc(Cl)c1C(=O)N(C)C |
| InChI | InChI=1S/C16H23ClN4O5/c1-10(6-4-5-9-18-16(23)24)19-14-12(21(25)26)8-7-11(17)13(14)15(22)20(2)3/h7-8,10,18-19H,4-6,9H2,1-3H3,(H,23,24)/t10-/m1/s1 |
| InChIKey | GQVUZWFJARDGJK-SNVBAGLBSA-N |
| XLogP | 3.19 |
| TPSA | 124.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.84 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|