C16H23ClN4O5 — CID 175520943
[(5S)-5-[3-chloro-2-(dimethylcarbamoyl)-6-nitroanilino]hexyl] carbamate (PubChem CID 175520943) has the molecular formula C16H23ClN4O5 and a molecular weight of 386.84 g/mol. Its IUPAC name is [(5S)-5-[3-chloro-2-(dimethylcarbamoyl)-6-nitroanilino]hexyl] carbamate.
| Compound Name | [(5S)-5-[3-chloro-2-(dimethylcarbamoyl)-6-nitroanilino]hexyl] carbamate |
|---|---|
| PubChem CID | 175520943 |
| Molecular Formula | C16H23ClN4O5 |
| Molecular Weight | 386.84 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | [(5S)-5-[3-chloro-2-(dimethylcarbamoyl)-6-nitroanilino]hexyl] carbamate |
| SMILES | C[C@@H](CCCCOC(N)=O)Nc1c([N+](=O)[O-])ccc(Cl)c1C(=O)N(C)C |
| InChI | InChI=1S/C16H23ClN4O5/c1-10(6-4-5-9-26-16(18)23)19-14-12(21(24)25)8-7-11(17)13(14)15(22)20(2)3/h7-8,10,19H,4-6,9H2,1-3H3,(H2,18,23)/t10-/m0/s1 |
| InChIKey | ZTCXVWXTUUVHLZ-JTQLQIEISA-N |
| XLogP | 3.02 |
| TPSA | 127.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.84 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|