C18H26N4O6 — CID 175521013
[(5R)-5-[4-acetyl-2-(dimethylcarbamoyl)-6-nitroanilino]hexyl] carbamate (PubChem CID 175521013) has the molecular formula C18H26N4O6 and a molecular weight of 394.43 g/mol. Its IUPAC name is [(5R)-5-[4-acetyl-2-(dimethylcarbamoyl)-6-nitroanilino]hexyl] carbamate.
| Compound Name | [(5R)-5-[4-acetyl-2-(dimethylcarbamoyl)-6-nitroanilino]hexyl] carbamate |
|---|---|
| PubChem CID | 175521013 |
| Molecular Formula | C18H26N4O6 |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | [(5R)-5-[4-acetyl-2-(dimethylcarbamoyl)-6-nitroanilino]hexyl] carbamate |
| SMILES | CC(=O)c1cc(C(=O)N(C)C)c(N[C@H](C)CCCCOC(N)=O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H26N4O6/c1-11(7-5-6-8-28-18(19)25)20-16-14(17(24)21(3)4)9-13(12(2)23)10-15(16)22(26)27/h9-11,20H,5-8H2,1-4H3,(H2,19,25)/t11-/m1/s1 |
| InChIKey | OEAJOFRTBUAZHI-LLVKDONJSA-N |
| XLogP | 2.57 |
| TPSA | 144.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|