C22H34N4O6 — CID 175520929
tert-butyl N-[5-[4-acetyl-2-(dimethylcarbamoyl)-6-nitroanilino]hexyl]carbamate (PubChem CID 175520929) has the molecular formula C22H34N4O6 and a molecular weight of 450.54 g/mol. Its IUPAC name is tert-butyl N-[5-[4-acetyl-2-(dimethylcarbamoyl)-6-nitroanilino]hexyl]carbamate.
| Compound Name | tert-butyl N-[5-[4-acetyl-2-(dimethylcarbamoyl)-6-nitroanilino]hexyl]carbamate |
|---|---|
| PubChem CID | 175520929 |
| Molecular Formula | C22H34N4O6 |
| Molecular Weight | 450.54 g/mol |
| Exact Mass | 450.25 |
| IUPAC Name | tert-butyl N-[5-[4-acetyl-2-(dimethylcarbamoyl)-6-nitroanilino]hexyl]carbamate |
| SMILES | CC(=O)c1cc(C(=O)N(C)C)c(NC(C)CCCCNC(=O)OC(C)(C)C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H34N4O6/c1-14(10-8-9-11-23-21(29)32-22(3,4)5)24-19-17(20(28)25(6)7)12-16(15(2)27)13-18(19)26(30)31/h12-14,24H,8-11H2,1-7H3,(H,23,29) |
| InChIKey | MFKSIJVVMMEDOZ-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 130.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.54 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|