C27H25NO — CID 172725867
1-cyclohepta-1,3,5-trien-1-yl-1-[4-(N-phenylanilino)phenyl]ethanol (PubChem CID 172725867) has the molecular formula C27H25NO and a molecular weight of 379.50 g/mol. Its IUPAC name is 1-cyclohepta-1,3,5-trien-1-yl-1-[4-(N-phenylanilino)phenyl]ethanol.
| Compound Name | 1-cyclohepta-1,3,5-trien-1-yl-1-[4-(N-phenylanilino)phenyl]ethanol |
|---|---|
| PubChem CID | 172725867 |
| Molecular Formula | C27H25NO |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | 1-cyclohepta-1,3,5-trien-1-yl-1-[4-(N-phenylanilino)phenyl]ethanol |
| SMILES | CC(O)(C1=CC=CC=CC1)c1ccc(N(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C27H25NO/c1-27(29,22-12-6-2-3-7-13-22)23-18-20-26(21-19-23)28(24-14-8-4-9-15-24)25-16-10-5-11-17-25/h2-12,14-21,29H,13H2,1H3 |
| InChIKey | HDGVQBNBSYGPPR-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |