About 1-ethyl-2H-pyridine;1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonamide
1-ethyl-2H-pyridine;1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonamide (PubChem CID 172732295) has the molecular formula C9H12F6N2O4S2
and a molecular weight of 390.33 g/mol. Its IUPAC name is 1-ethyl-2H-pyridine;1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonamide.
Molecular Properties
| Compound Name | 1-ethyl-2H-pyridine;1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonamide |
| PubChem CID | 172732295 |
| Molecular Formula | C9H12F6N2O4S2 |
| Molecular Weight | 390.33 g/mol |
| Exact Mass | 390.01 |
| IUPAC Name | 1-ethyl-2H-pyridine;1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonamide |
| SMILES | CCN1C=CC=CC1.O=S(=O)(NS(=O)(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C7H11N.C2HF6NO4S2/c1-2-8-6-4-3-5-7-8;3-1(4,5)14(10,11)9-15(12,13)2(6,7)8/h3-6H,2,7H2,1H3;9H |
| InChIKey | HYOUPNGRBRKHSN-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 390.33 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-ethyl-2H-pyridine;1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-2H-pyridine;1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonamide?
The IUPAC name of 1-ethyl-2H-pyridine;1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonamide (CID 172732295) is 1-ethyl-2H-pyridine;1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonamide.
What is the SMILES notation for 1-ethyl-2H-pyridine;1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonamide?
The canonical SMILES for 1-ethyl-2H-pyridine;1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonamide is CCN1C=CC=CC1.O=S(=O)(NS(=O)(=O)C(F)(F)F)C(F)(F)F.
What is the InChIKey of 1-ethyl-2H-pyridine;1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonamide?
The InChIKey is HYOUPNGRBRKHSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11N.C2HF6NO4S2/c1-2-8-6-4-3-5-7-8;3-1(4,5)14(10,11)9-15(12,13)2(6,7)8/h3-6H,2,7H2,1H3;9H.
What are the key properties of 1-ethyl-2H-pyridine;1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonamide?
1-ethyl-2H-pyridine;1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonamide has a molecular weight of 390.33 g/mol, XLogP of 1.67, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-2H-pyridine;1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonamide is sourced from PubChem (CID 172732295), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).