C24H32O4 — CID 172734966
[2-[(4-ethyl-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl)oxy]-2-oxoethyl] bicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 172734966) has the molecular formula C24H32O4 and a molecular weight of 384.52 g/mol. Its IUPAC name is [2-[(4-ethyl-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl)oxy]-2-oxoethyl] bicyclo[2.2.1]hept-5-ene-2-carboxylate.
| Compound Name | [2-[(4-ethyl-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl)oxy]-2-oxoethyl] bicyclo[2.2.1]hept-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 172734966 |
| Molecular Formula | C24H32O4 |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.23 |
| IUPAC Name | [2-[(4-ethyl-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl)oxy]-2-oxoethyl] bicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | CCC1(OC(=O)COC(=O)C2CC3C=CC2C3)CC2CC1C1C3CCC(C3)C21 |
| InChI | InChI=1S/C24H32O4/c1-2-24(11-17-10-19(24)22-16-6-5-15(9-16)21(17)22)28-20(25)12-27-23(26)18-8-13-3-4-14(18)7-13/h3-4,13-19,21-22H,2,5-12H2,1H3 |
| InChIKey | IHPWIRNFEMSYOJ-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|