About (2-butylphenyl)-diphenylphosphane;thiocyanic acid
(2-butylphenyl)-diphenylphosphane;thiocyanic acid (PubChem CID 172735043) has the molecular formula C23H24NPS
and a molecular weight of 377.49 g/mol. Its IUPAC name is (2-butylphenyl)-diphenylphosphane;thiocyanic acid.
Molecular Properties
| Compound Name | (2-butylphenyl)-diphenylphosphane;thiocyanic acid |
| PubChem CID | 172735043 |
| Molecular Formula | C23H24NPS |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | (2-butylphenyl)-diphenylphosphane;thiocyanic acid |
| SMILES | CCCCc1ccccc1P(c1ccccc1)c1ccccc1.N#CS |
| InChI | InChI=1S/C22H23P.CHNS/c1-2-3-12-19-13-10-11-18-22(19)23(20-14-6-4-7-15-20)21-16-8-5-9-17-21;2-1-3/h4-11,13-18H,2-3,12H2,1H3;3H |
| InChIKey | IHWHUUVEOOUDOS-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 23.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (2-butylphenyl)-diphenylphosphane;thiocyanic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-butylphenyl)-diphenylphosphane;thiocyanic acid?
The IUPAC name of (2-butylphenyl)-diphenylphosphane;thiocyanic acid (CID 172735043) is (2-butylphenyl)-diphenylphosphane;thiocyanic acid.
What is the SMILES notation for (2-butylphenyl)-diphenylphosphane;thiocyanic acid?
The canonical SMILES for (2-butylphenyl)-diphenylphosphane;thiocyanic acid is CCCCc1ccccc1P(c1ccccc1)c1ccccc1.N#CS.
What is the InChIKey of (2-butylphenyl)-diphenylphosphane;thiocyanic acid?
The InChIKey is IHWHUUVEOOUDOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H23P.CHNS/c1-2-3-12-19-13-10-11-18-22(19)23(20-14-6-4-7-15-20)21-16-8-5-9-17-21;2-1-3/h4-11,13-18H,2-3,12H2,1H3;3H.
What are the key properties of (2-butylphenyl)-diphenylphosphane;thiocyanic acid?
(2-butylphenyl)-diphenylphosphane;thiocyanic acid has a molecular weight of 377.49 g/mol, XLogP of 5.18, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2-butylphenyl)-diphenylphosphane;thiocyanic acid is sourced from PubChem (CID 172735043), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).