C21H29N3O3 — CID 172737581
3-methoxy-1-[1-(4-methoxynaphthalen-1-yl)ethyl]-1-[(2S)-1-methylpiperidin-2-yl]urea (PubChem CID 172737581) has the molecular formula C21H29N3O3 and a molecular weight of 371.48 g/mol. Its IUPAC name is 3-methoxy-1-[1-(4-methoxynaphthalen-1-yl)ethyl]-1-[(2S)-1-methylpiperidin-2-yl]urea.
| Compound Name | 3-methoxy-1-[1-(4-methoxynaphthalen-1-yl)ethyl]-1-[(2S)-1-methylpiperidin-2-yl]urea |
|---|---|
| PubChem CID | 172737581 |
| Molecular Formula | C21H29N3O3 |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.22 |
| IUPAC Name | 3-methoxy-1-[1-(4-methoxynaphthalen-1-yl)ethyl]-1-[(2S)-1-methylpiperidin-2-yl]urea |
| SMILES | CONC(=O)N(C(C)c1ccc(OC)c2ccccc12)[C@H]1CCCCN1C |
| InChI | InChI=1S/C21H29N3O3/c1-15(16-12-13-19(26-3)18-10-6-5-9-17(16)18)24(21(25)22-27-4)20-11-7-8-14-23(20)2/h5-6,9-10,12-13,15,20H,7-8,11,14H2,1-4H3,(H,22,25)/t15?,20-/m0/s1 |
| InChIKey | IQOUOCSCKCSJJL-MBABXSBOSA-N |
| XLogP | 3.92 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|