C17H25Cl2N3O4 — CID 172750824
3-[1-[2,3-bis(chloromethoxy)phenyl]ethyl]-1-hydroxy-1-[(2R)-1-methylpiperidin-2-yl]urea (PubChem CID 172750824) has the molecular formula C17H25Cl2N3O4 and a molecular weight of 406.31 g/mol. Its IUPAC name is 3-[1-[2,3-bis(chloromethoxy)phenyl]ethyl]-1-hydroxy-1-[(2R)-1-methylpiperidin-2-yl]urea.
| Compound Name | 3-[1-[2,3-bis(chloromethoxy)phenyl]ethyl]-1-hydroxy-1-[(2R)-1-methylpiperidin-2-yl]urea |
|---|---|
| PubChem CID | 172750824 |
| Molecular Formula | C17H25Cl2N3O4 |
| Molecular Weight | 406.31 g/mol |
| Exact Mass | 405.12 |
| IUPAC Name | 3-[1-[2,3-bis(chloromethoxy)phenyl]ethyl]-1-hydroxy-1-[(2R)-1-methylpiperidin-2-yl]urea |
| SMILES | CC(NC(=O)N(O)[C@@H]1CCCCN1C)c1cccc(OCCl)c1OCCl |
| InChI | InChI=1S/C17H25Cl2N3O4/c1-12(13-6-5-7-14(25-10-18)16(13)26-11-19)20-17(23)22(24)15-8-3-4-9-21(15)2/h5-7,12,15,24H,3-4,8-11H2,1-2H3,(H,20,23)/t12?,15-/m1/s1 |
| InChIKey | KISCEQUTSFVOMK-WPZCJLIBSA-N |
| XLogP | 3.74 |
| TPSA | 74.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.31 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|