C18H27Cl2N3O3 — CID 172745026
3-[1-[2,3-bis(chloromethoxy)phenyl]ethyl]-1-methyl-1-(1-methylpiperidin-2-yl)urea (PubChem CID 172745026) has the molecular formula C18H27Cl2N3O3 and a molecular weight of 404.34 g/mol. Its IUPAC name is 3-[1-[2,3-bis(chloromethoxy)phenyl]ethyl]-1-methyl-1-(1-methylpiperidin-2-yl)urea.
| Compound Name | 3-[1-[2,3-bis(chloromethoxy)phenyl]ethyl]-1-methyl-1-(1-methylpiperidin-2-yl)urea |
|---|---|
| PubChem CID | 172745026 |
| Molecular Formula | C18H27Cl2N3O3 |
| Molecular Weight | 404.34 g/mol |
| Exact Mass | 403.14 |
| IUPAC Name | 3-[1-[2,3-bis(chloromethoxy)phenyl]ethyl]-1-methyl-1-(1-methylpiperidin-2-yl)urea |
| SMILES | CC(NC(=O)N(C)C1CCCCN1C)c1cccc(OCCl)c1OCCl |
| InChI | InChI=1S/C18H27Cl2N3O3/c1-13(14-7-6-8-15(25-11-19)17(14)26-12-20)21-18(24)23(3)16-9-4-5-10-22(16)2/h6-8,13,16H,4-5,9-12H2,1-3H3,(H,21,24) |
| InChIKey | JPJPSLTZHUILFH-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.34 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|