About dichloromethane;4-(dimethylamino)-4-oxobutanoic acid;N-methylmethanamine
dichloromethane;4-(dimethylamino)-4-oxobutanoic acid;N-methylmethanamine (PubChem CID 172740638) has the molecular formula C9H20Cl2N2O3
and a molecular weight of 275.18 g/mol. Its IUPAC name is dichloromethane;4-(dimethylamino)-4-oxobutanoic acid;N-methylmethanamine.
Molecular Properties
| Compound Name | dichloromethane;4-(dimethylamino)-4-oxobutanoic acid;N-methylmethanamine |
| PubChem CID | 172740638 |
| Molecular Formula | C9H20Cl2N2O3 |
| Molecular Weight | 275.18 g/mol |
| Exact Mass | 274.09 |
| IUPAC Name | dichloromethane;4-(dimethylamino)-4-oxobutanoic acid;N-methylmethanamine |
| SMILES | CN(C)C(=O)CCC(=O)O.CNC.ClCCl |
| InChI | InChI=1S/C6H11NO3.C2H7N.CH2Cl2/c1-7(2)5(8)3-4-6(9)10;1-3-2;2-1-3/h3-4H2,1-2H3,(H,9,10);3H,1-2H3;1H2 |
| InChIKey | JAWWNCVQVOHGOB-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.18 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze dichloromethane;4-(dimethylamino)-4-oxobutanoic acid;N-methylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichloromethane;4-(dimethylamino)-4-oxobutanoic acid;N-methylmethanamine?
The IUPAC name of dichloromethane;4-(dimethylamino)-4-oxobutanoic acid;N-methylmethanamine (CID 172740638) is dichloromethane;4-(dimethylamino)-4-oxobutanoic acid;N-methylmethanamine.
What is the SMILES notation for dichloromethane;4-(dimethylamino)-4-oxobutanoic acid;N-methylmethanamine?
The canonical SMILES for dichloromethane;4-(dimethylamino)-4-oxobutanoic acid;N-methylmethanamine is CN(C)C(=O)CCC(=O)O.CNC.ClCCl.
What is the InChIKey of dichloromethane;4-(dimethylamino)-4-oxobutanoic acid;N-methylmethanamine?
The InChIKey is JAWWNCVQVOHGOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NO3.C2H7N.CH2Cl2/c1-7(2)5(8)3-4-6(9)10;1-3-2;2-1-3/h3-4H2,1-2H3,(H,9,10);3H,1-2H3;1H2.
What are the key properties of dichloromethane;4-(dimethylamino)-4-oxobutanoic acid;N-methylmethanamine?
dichloromethane;4-(dimethylamino)-4-oxobutanoic acid;N-methylmethanamine has a molecular weight of 275.18 g/mol, XLogP of 1.20, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for dichloromethane;4-(dimethylamino)-4-oxobutanoic acid;N-methylmethanamine is sourced from PubChem (CID 172740638), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).