C15H25NO8 — CID 172742405
butane-1,2,3,4-tetracarboxylic acid;2-methylcyclohexan-1-amine (PubChem CID 172742405) has the molecular formula C15H25NO8 and a molecular weight of 347.36 g/mol. Its IUPAC name is butane-1,2,3,4-tetracarboxylic acid;2-methylcyclohexan-1-amine.
| Compound Name | butane-1,2,3,4-tetracarboxylic acid;2-methylcyclohexan-1-amine |
|---|---|
| PubChem CID | 172742405 |
| Molecular Formula | C15H25NO8 |
| Molecular Weight | 347.36 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | butane-1,2,3,4-tetracarboxylic acid;2-methylcyclohexan-1-amine |
| SMILES | CC1CCCCC1N.O=C(O)CC(C(=O)O)C(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C8H10O8.C7H15N/c9-5(10)1-3(7(13)14)4(8(15)16)2-6(11)12;1-6-4-2-3-5-7(6)8/h3-4H,1-2H2,(H,9,10)(H,11,12)(H,13,14)(H,15,16);6-7H,2-5,8H2,1H3 |
| InChIKey | JGUZKMPUWMYDBU-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 175.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.36 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |