About 1H-pyrrolo[2,3-b]pyridine-3-carboxylic acid;2,2,2-trifluoroacetic acid
1H-pyrrolo[2,3-b]pyridine-3-carboxylic acid;2,2,2-trifluoroacetic acid (PubChem CID 172745256) has the molecular formula C10H7F3N2O4
and a molecular weight of 276.17 g/mol. Its IUPAC name is 1H-pyrrolo[2,3-b]pyridine-3-carboxylic acid;2,2,2-trifluoroacetic acid.
Analyze 1H-pyrrolo[2,3-b]pyridine-3-carboxylic acid;2,2,2-trifluoroacetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-pyrrolo[2,3-b]pyridine-3-carboxylic acid;2,2,2-trifluoroacetic acid?
The IUPAC name of 1H-pyrrolo[2,3-b]pyridine-3-carboxylic acid;2,2,2-trifluoroacetic acid (CID 172745256) is 1H-pyrrolo[2,3-b]pyridine-3-carboxylic acid;2,2,2-trifluoroacetic acid.
What is the SMILES notation for 1H-pyrrolo[2,3-b]pyridine-3-carboxylic acid;2,2,2-trifluoroacetic acid?
The canonical SMILES for 1H-pyrrolo[2,3-b]pyridine-3-carboxylic acid;2,2,2-trifluoroacetic acid is O=C(O)C(F)(F)F.O=C(O)c1c[nH]c2ncccc12.
What is the InChIKey of 1H-pyrrolo[2,3-b]pyridine-3-carboxylic acid;2,2,2-trifluoroacetic acid?
The InChIKey is JQCNTTCIPLIIJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N2O2.C2HF3O2/c11-8(12)6-4-10-7-5(6)2-1-3-9-7;3-2(4,5)1(6)7/h1-4H,(H,9,10)(H,11,12);(H,6,7).
What are the key properties of 1H-pyrrolo[2,3-b]pyridine-3-carboxylic acid;2,2,2-trifluoroacetic acid?
1H-pyrrolo[2,3-b]pyridine-3-carboxylic acid;2,2,2-trifluoroacetic acid has a molecular weight of 276.17 g/mol, XLogP of 1.89, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-pyrrolo[2,3-b]pyridine-3-carboxylic acid;2,2,2-trifluoroacetic acid is sourced from PubChem (CID 172745256), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).