C17H17ClN2O3S — CID 172750018
2-(1-acetyl-3,4-dihydro-2H-quinolin-7-yl)-5-chloro-1-ethyl-1,3-thiazol-1-ium-4-carboxylate (PubChem CID 172750018) has the molecular formula C17H17ClN2O3S and a molecular weight of 364.85 g/mol. Its IUPAC name is 2-(1-acetyl-3,4-dihydro-2H-quinolin-7-yl)-5-chloro-1-ethyl-1,3-thiazol-1-ium-4-carboxylate.
| Compound Name | 2-(1-acetyl-3,4-dihydro-2H-quinolin-7-yl)-5-chloro-1-ethyl-1,3-thiazol-1-ium-4-carboxylate |
|---|---|
| PubChem CID | 172750018 |
| Molecular Formula | C17H17ClN2O3S |
| Molecular Weight | 364.85 g/mol |
| Exact Mass | 364.06 |
| IUPAC Name | 2-(1-acetyl-3,4-dihydro-2H-quinolin-7-yl)-5-chloro-1-ethyl-1,3-thiazol-1-ium-4-carboxylate |
| SMILES | CC[s+]1c(-c2ccc3c(c2)N(C(C)=O)CCC3)nc(C(=O)[O-])c1Cl |
| InChI | InChI=1S/C17H17ClN2O3S/c1-3-24-15(18)14(17(22)23)19-16(24)12-7-6-11-5-4-8-20(10(2)21)13(11)9-12/h6-7,9H,3-5,8H2,1-2H3 |
| InChIKey | KFYQRDAIZTUREM-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 73.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.85 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|