About 2-(8-methylnaphthalen-1-yl)-1,3,2-dioxaborolane
2-(8-methylnaphthalen-1-yl)-1,3,2-dioxaborolane (PubChem CID 172750992) has the molecular formula C13H13BO2
and a molecular weight of 212.06 g/mol. Its IUPAC name is 2-(8-methylnaphthalen-1-yl)-1,3,2-dioxaborolane.
Molecular Properties
| Compound Name | 2-(8-methylnaphthalen-1-yl)-1,3,2-dioxaborolane |
| PubChem CID | 172750992 |
| Molecular Formula | C13H13BO2 |
| Molecular Weight | 212.06 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | 2-(8-methylnaphthalen-1-yl)-1,3,2-dioxaborolane |
| SMILES | Cc1cccc2cccc(B3OCCO3)c12 |
| InChI | InChI=1S/C13H13BO2/c1-10-4-2-5-11-6-3-7-12(13(10)11)14-15-8-9-16-14/h2-7H,8-9H2,1H3 |
| InChIKey | KJGMMALNPQPXME-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.06 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-(8-methylnaphthalen-1-yl)-1,3,2-dioxaborolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(8-methylnaphthalen-1-yl)-1,3,2-dioxaborolane?
The IUPAC name of 2-(8-methylnaphthalen-1-yl)-1,3,2-dioxaborolane (CID 172750992) is 2-(8-methylnaphthalen-1-yl)-1,3,2-dioxaborolane.
What is the SMILES notation for 2-(8-methylnaphthalen-1-yl)-1,3,2-dioxaborolane?
The canonical SMILES for 2-(8-methylnaphthalen-1-yl)-1,3,2-dioxaborolane is Cc1cccc2cccc(B3OCCO3)c12.
What is the InChIKey of 2-(8-methylnaphthalen-1-yl)-1,3,2-dioxaborolane?
The InChIKey is KJGMMALNPQPXME-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13BO2/c1-10-4-2-5-11-6-3-7-12(13(10)11)14-15-8-9-16-14/h2-7H,8-9H2,1H3.
What are the key properties of 2-(8-methylnaphthalen-1-yl)-1,3,2-dioxaborolane?
2-(8-methylnaphthalen-1-yl)-1,3,2-dioxaborolane has a molecular weight of 212.06 g/mol, XLogP of 1.89, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(8-methylnaphthalen-1-yl)-1,3,2-dioxaborolane is sourced from PubChem (CID 172750992), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).