C19H23N5O3 — CID 172755567
tert-butyl 4-(4-oxo-3,7,8,10-tetrazatricyclo[7.4.0.02,7]trideca-1,5,8,10,12-pentaen-3-yl)piperidine-1-carboxylate (PubChem CID 172755567) has the molecular formula C19H23N5O3 and a molecular weight of 369.43 g/mol. Its IUPAC name is tert-butyl 4-(4-oxo-3,7,8,10-tetrazatricyclo[7.4.0.02,7]trideca-1,5,8,10,12-pentaen-3-yl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(4-oxo-3,7,8,10-tetrazatricyclo[7.4.0.02,7]trideca-1,5,8,10,12-pentaen-3-yl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 172755567 |
| Molecular Formula | C19H23N5O3 |
| Molecular Weight | 369.43 g/mol |
| Exact Mass | 369.18 |
| IUPAC Name | tert-butyl 4-(4-oxo-3,7,8,10-tetrazatricyclo[7.4.0.02,7]trideca-1,5,8,10,12-pentaen-3-yl)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(n2c(=O)ccn3nc4ncccc4c23)CC1 |
| InChI | InChI=1S/C19H23N5O3/c1-19(2,3)27-18(26)22-10-6-13(7-11-22)24-15(25)8-12-23-17(24)14-5-4-9-20-16(14)21-23/h4-5,8-9,12-13H,6-7,10-11H2,1-3H3 |
| InChIKey | KYYBHHIUXKYNDN-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 81.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.43 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |