C21H35NO8 — CID 172755881
3,4-dimethyl-2-(1,2,2,6,6-pentamethylpiperidin-3-yl)pentane-1,2,3,4-tetracarboxylic acid (PubChem CID 172755881) has the molecular formula C21H35NO8 and a molecular weight of 429.51 g/mol. Its IUPAC name is 3,4-dimethyl-2-(1,2,2,6,6-pentamethylpiperidin-3-yl)pentane-1,2,3,4-tetracarboxylic acid.
| Compound Name | 3,4-dimethyl-2-(1,2,2,6,6-pentamethylpiperidin-3-yl)pentane-1,2,3,4-tetracarboxylic acid |
|---|---|
| PubChem CID | 172755881 |
| Molecular Formula | C21H35NO8 |
| Molecular Weight | 429.51 g/mol |
| Exact Mass | 429.24 |
| IUPAC Name | 3,4-dimethyl-2-(1,2,2,6,6-pentamethylpiperidin-3-yl)pentane-1,2,3,4-tetracarboxylic acid |
| SMILES | CN1C(C)(C)CCC(C(CC(=O)O)(C(=O)O)C(C)(C(=O)O)C(C)(C)C(=O)O)C1(C)C |
| InChI | InChI=1S/C21H35NO8/c1-17(2)10-9-12(19(5,6)22(17)8)21(16(29)30,11-13(23)24)20(7,15(27)28)18(3,4)14(25)26/h12H,9-11H2,1-8H3,(H,23,24)(H,25,26)(H,27,28)(H,29,30) |
| InChIKey | LABOEYFXRQDLHO-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 152.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.51 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |